C32H31NO7 — CID 10875236
benzyl (1R,9S,13S)-13-hydroxy-4,11-dimethoxy-12-oxo-3-phenylmethoxy-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5,10-tetraene-16-carboxylate (PubChem CID 10875236) has the molecular formula C32H31NO7 and a molecular weight of 541.60 g/mol. Its IUPAC name is benzyl (1R,9S,13S)-13-hydroxy-4,11-dimethoxy-12-oxo-3-phenylmethoxy-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5,10-tetraene-16-carboxylate.
| Compound Name | benzyl (1R,9S,13S)-13-hydroxy-4,11-dimethoxy-12-oxo-3-phenylmethoxy-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5,10-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 10875236 |
| Molecular Formula | C32H31NO7 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | benzyl (1R,9S,13S)-13-hydroxy-4,11-dimethoxy-12-oxo-3-phenylmethoxy-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,5,10-tetraene-16-carboxylate |
| SMILES | COC1=C2[C@@H]3Cc4ccc(OC)c(OCc5ccccc5)c4[C@@]2(C[C@H](O)C1=O)CN3C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H31NO7/c1-37-25-14-13-22-15-23-27-30(38-2)28(35)24(34)16-32(27,26(22)29(25)39-17-20-9-5-3-6-10-20)19-33(23)31(36)40-18-21-11-7-4-8-12-21/h3-14,23-24,34H,15-19H2,1-2H3/t23-,24-,32+/m0/s1 |
| InChIKey | KBYNSEGJIBUGSF-TXAHVWHTSA-N |
| XLogP | 4.32 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |