C29H32N8O4 — CID 10875368
5,12-ditert-butyl-3,10-bis(4-nitrophenyl)-1,3,4,8,10,11-hexazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene (PubChem CID 10875368) has the molecular formula C29H32N8O4 and a molecular weight of 556.63 g/mol. Its IUPAC name is 5,12-ditert-butyl-3,10-bis(4-nitrophenyl)-1,3,4,8,10,11-hexazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene.
| Compound Name | 5,12-ditert-butyl-3,10-bis(4-nitrophenyl)-1,3,4,8,10,11-hexazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene |
|---|---|
| PubChem CID | 10875368 |
| Molecular Formula | C29H32N8O4 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 5,12-ditert-butyl-3,10-bis(4-nitrophenyl)-1,3,4,8,10,11-hexazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene |
| SMILES | CC(C)(C)c1nn(-c2ccc([N+](=O)[O-])cc2)c2c1CN1CN2Cc2c(C(C)(C)C)nn(-c3ccc([N+](=O)[O-])cc3)c21 |
| InChI | InChI=1S/C29H32N8O4/c1-28(2,3)24-22-15-32-17-33(26(22)34(30-24)18-7-11-20(12-8-18)36(38)39)16-23-25(29(4,5)6)31-35(27(23)32)19-9-13-21(14-10-19)37(40)41/h7-14H,15-17H2,1-6H3 |
| InChIKey | GMAHHWMZUNTKBD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 128.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|