C28H32N8O4 — CID 135475703
3-tert-butyl-5-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-1-(4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine (PubChem CID 135475703) has the molecular formula C28H32N8O4 and a molecular weight of 544.62 g/mol. Its IUPAC name is 3-tert-butyl-5-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-1-(4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine.
| Compound Name | 3-tert-butyl-5-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-1-(4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 135475703 |
| Molecular Formula | C28H32N8O4 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 3-tert-butyl-5-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-1-(4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine |
| SMILES | CC(C)(C)c1cc(N2CNc3c(c(C(C)(C)C)nn3-c3ccc([N+](=O)[O-])cc3)C2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C28H32N8O4/c1-27(2,3)23-15-24(33(30-23)18-7-11-20(12-8-18)35(37)38)32-16-22-25(28(4,5)6)31-34(26(22)29-17-32)19-9-13-21(14-10-19)36(39)40/h7-15,29H,16-17H2,1-6H3 |
| InChIKey | WRMKDASGSKRVEV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 137.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|