C25H25N3O4S — CID 108754646
(E)-3-(3,4-dimethoxyphenyl)-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 108754646) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108754646 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nc(-c3ccc4c(c3)C(C)(C)C(=O)N4C)cs2)cc1OC |
| InChI | InChI=1S/C25H25N3O4S/c1-25(2)17-13-16(8-9-19(17)28(3)23(25)30)18-14-33-24(26-18)27-22(29)11-7-15-6-10-20(31-4)21(12-15)32-5/h6-14H,1-5H3,(H,26,27,29)/b11-7+ |
| InChIKey | GSAJQDQQUIFNEW-YRNVUSSQSA-N |
| XLogP | 4.73 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|