C34H49NO4SSi — CID 10875688
[(1R,2E,6E)-5-(benzenesulfonyl)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hexadeca-2,6-dienoxy]-trimethylsilane (PubChem CID 10875688) has the molecular formula C34H49NO4SSi and a molecular weight of 595.92 g/mol. Its IUPAC name is [(1R,2E,6E)-5-(benzenesulfonyl)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hexadeca-2,6-dienoxy]-trimethylsilane.
| Compound Name | [(1R,2E,6E)-5-(benzenesulfonyl)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hexadeca-2,6-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10875688 |
| Molecular Formula | C34H49NO4SSi |
| Molecular Weight | 595.92 g/mol |
| Exact Mass | 595.32 |
| IUPAC Name | [(1R,2E,6E)-5-(benzenesulfonyl)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]hexadeca-2,6-dienoxy]-trimethylsilane |
| SMILES | CCCCCCCCC/C=C/C(C/C=C/[C@@H](O[Si](C)(C)C)[C@@H]1COC(c2ccccc2)=N1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H49NO4SSi/c1-5-6-7-8-9-10-11-12-17-23-31(40(36,37)30-24-18-14-19-25-30)26-20-27-33(39-41(2,3)4)32-28-38-34(35-32)29-21-15-13-16-22-29/h13-25,27,31-33H,5-12,26,28H2,1-4H3/b23-17+,27-20+/t31?,32-,33+/m0/s1 |
| InChIKey | DSTKWEMZZJFAOZ-PWMCGPEASA-N |
| XLogP | 8.54 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.92 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|