C14H10Cl2N4O — CID 108759949
(E)-N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 108759949) has the molecular formula C14H10Cl2N4O and a molecular weight of 321.17 g/mol. Its IUPAC name is (E)-N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108759949 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | (E)-N-(4-cyano-1-methylpyrazol-5-yl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | Cn1ncc(C#N)c1NC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N4O/c1-20-14(10(7-17)8-18-20)19-13(21)5-3-9-2-4-11(15)6-12(9)16/h2-6,8H,1H3,(H,19,21)/b5-3+ |
| InChIKey | MKDHYWDWLGEDBO-HWKANZROSA-N |
| XLogP | 3.25 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|