C23H24N2O5S — CID 108766812
2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-ethylsulfanylbutanoic acid (PubChem CID 108766812) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108766812 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(NC(=O)c1ccc2c(c1)C(=O)N(c1cc(C)ccc1C)C2=O)C(=O)O |
| InChI | InChI=1S/C23H24N2O5S/c1-4-31-10-9-18(23(29)30)24-20(26)15-7-8-16-17(12-15)22(28)25(21(16)27)19-11-13(2)5-6-14(19)3/h5-8,11-12,18H,4,9-10H2,1-3H3,(H,24,26)(H,29,30) |
| InChIKey | LSDAFWACCCULDL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|