C25H22N4O4 — CID 108768795
[2-methoxy-4-[(E)-3-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 108768795) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-3-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 108768795 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [2-methoxy-4-[(E)-3-[(5-methyl-2-quinolin-2-ylpyrazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(C)nn2-c2ccc3ccccc3n2)ccc1OC(C)=O |
| InChI | InChI=1S/C25H22N4O4/c1-16-14-24(29(28-16)23-12-10-19-6-4-5-7-20(19)26-23)27-25(31)13-9-18-8-11-21(33-17(2)30)22(15-18)32-3/h4-15H,1-3H3,(H,27,31)/b13-9+ |
| InChIKey | PUWKHOHKUOMDBA-UKTHLTGXSA-N |
| XLogP | 4.31 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|