C16H12Cl2N6O2 — CID 108771592
5-(6-chloro-5-nitropyrimidin-4-yl)-3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 108771592) has the molecular formula C16H12Cl2N6O2 and a molecular weight of 391.22 g/mol. Its IUPAC name is 5-(6-chloro-5-nitropyrimidin-4-yl)-3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 5-(6-chloro-5-nitropyrimidin-4-yl)-3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 108771592 |
| Molecular Formula | C16H12Cl2N6O2 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 5-(6-chloro-5-nitropyrimidin-4-yl)-3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1N1CCc2[nH]nc(-c3cccc(Cl)c3)c2C1 |
| InChI | InChI=1S/C16H12Cl2N6O2/c17-10-3-1-2-9(6-10)13-11-7-23(5-4-12(11)21-22-13)16-14(24(25)26)15(18)19-8-20-16/h1-3,6,8H,4-5,7H2,(H,21,22) |
| InChIKey | ZRMROZCKQKGTPA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|