C23H15ClN4S — CID 108772125
3-chloro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]quinoxalin-2-amine (PubChem CID 108772125) has the molecular formula C23H15ClN4S and a molecular weight of 414.92 g/mol. Its IUPAC name is 3-chloro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]quinoxalin-2-amine.
| Compound Name | 3-chloro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 108772125 |
| Molecular Formula | C23H15ClN4S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3-chloro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]quinoxalin-2-amine |
| SMILES | Clc1nc2ccccc2nc1Nc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H15ClN4S/c24-21-22(27-19-9-5-4-8-18(19)26-21)25-17-12-10-15(11-13-17)20-14-29-23(28-20)16-6-2-1-3-7-16/h1-14H,(H,25,27) |
| InChIKey | GQZVSPMJFGIMNU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |