C23H22ClN5 — CID 108773344
2-chloro-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]quinoxaline (PubChem CID 108773344) has the molecular formula C23H22ClN5 and a molecular weight of 403.92 g/mol. Its IUPAC name is 2-chloro-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]quinoxaline.
| Compound Name | 2-chloro-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 108773344 |
| Molecular Formula | C23H22ClN5 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-chloro-3-[4-(4,8-dimethylquinolin-2-yl)piperazin-1-yl]quinoxaline |
| SMILES | Cc1cc(N2CCN(c3nc4ccccc4nc3Cl)CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C23H22ClN5/c1-15-6-5-7-17-16(2)14-20(27-21(15)17)28-10-12-29(13-11-28)23-22(24)25-18-8-3-4-9-19(18)26-23/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | HAZJVINNTWZXFU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |