C22H13ClN8O2S — CID 108773841
2-[[5-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione (PubChem CID 108773841) has the molecular formula C22H13ClN8O2S and a molecular weight of 488.92 g/mol. Its IUPAC name is 2-[[5-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108773841 |
| Molecular Formula | C22H13ClN8O2S |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 2-[[5-[[1-(3-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nnc(Nc2ncnc3c2cnn3-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C22H13ClN8O2S/c23-12-4-3-5-13(8-12)31-19-16(9-26-31)18(24-11-25-19)27-22-29-28-17(34-22)10-30-20(32)14-6-1-2-7-15(14)21(30)33/h1-9,11H,10H2,(H,24,25,27,29) |
| InChIKey | XJULKIAXZCKHNP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|