C20H14N4S — CID 108774105
N-(1H-benzimidazol-2-yl)-4-naphthalen-2-yl-1,3-thiazol-2-amine (PubChem CID 108774105) has the molecular formula C20H14N4S and a molecular weight of 342.43 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-4-naphthalen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(1H-benzimidazol-2-yl)-4-naphthalen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 108774105 |
| Molecular Formula | C20H14N4S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-4-naphthalen-2-yl-1,3-thiazol-2-amine |
| SMILES | c1ccc2cc(-c3csc(Nc4nc5ccccc5[nH]4)n3)ccc2c1 |
| InChI | InChI=1S/C20H14N4S/c1-2-6-14-11-15(10-9-13(14)5-1)18-12-25-20(23-18)24-19-21-16-7-3-4-8-17(16)22-19/h1-12H,(H2,21,22,23,24) |
| InChIKey | ITZQIKPYLNPCDJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |