C20H26N4O4S — CID 108775073
ethyl 4-[2-[4-(cyclopentylsulfamoyl)phenyl]ethylamino]pyrimidine-5-carboxylate (PubChem CID 108775073) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 4-[2-[4-(cyclopentylsulfamoyl)phenyl]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[2-[4-(cyclopentylsulfamoyl)phenyl]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 108775073 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 4-[2-[4-(cyclopentylsulfamoyl)phenyl]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cncnc1NCCc1ccc(S(=O)(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C20H26N4O4S/c1-2-28-20(25)18-13-21-14-23-19(18)22-12-11-15-7-9-17(10-8-15)29(26,27)24-16-5-3-4-6-16/h7-10,13-14,16,24H,2-6,11-12H2,1H3,(H,21,22,23) |
| InChIKey | RLUHDUIFJLYNJJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |