C23H25FN4 — CID 108775540
6-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]pyridazin-3-amine (PubChem CID 108775540) has the molecular formula C23H25FN4 and a molecular weight of 376.48 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]pyridazin-3-amine.
| Compound Name | 6-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 108775540 |
| Molecular Formula | C23H25FN4 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 6-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]pyridazin-3-amine |
| SMILES | CC1CCN(Cc2ccc(Nc3ccc(-c4ccc(F)cc4)nn3)cc2)CC1 |
| InChI | InChI=1S/C23H25FN4/c1-17-12-14-28(15-13-17)16-18-2-8-21(9-3-18)25-23-11-10-22(26-27-23)19-4-6-20(24)7-5-19/h2-11,17H,12-16H2,1H3,(H,25,27) |
| InChIKey | ZYNQRYLWXVTOER-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |