C10H9NO3 — CID 10877951
(3R)-4-oxido-3-phenyl-2,3-dihydro-1,4-oxazin-4-ium-6-one (PubChem CID 10877951) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is (3R)-4-oxido-3-phenyl-2,3-dihydro-1,4-oxazin-4-ium-6-one.
| Compound Name | (3R)-4-oxido-3-phenyl-2,3-dihydro-1,4-oxazin-4-ium-6-one |
|---|---|
| PubChem CID | 10877951 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (3R)-4-oxido-3-phenyl-2,3-dihydro-1,4-oxazin-4-ium-6-one |
| SMILES | O=C1C=[N+]([O-])[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C10H9NO3/c12-10-6-11(13)9(7-14-10)8-4-2-1-3-5-8/h1-6,9H,7H2/t9-/m0/s1 |
| InChIKey | OSSLVTRJEPVTCN-VIFPVBQESA-N |
| XLogP | 0.87 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|