C25H29N3O2S2 — CID 108780117
1-cyclohexyl-3-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]thiourea (PubChem CID 108780117) has the molecular formula C25H29N3O2S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 108780117 |
| Molecular Formula | C25H29N3O2S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-cyclohexyl-3-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]thiourea |
| SMILES | COc1ccc(-c2csc(-c3ccc(CNC(=S)NC4CCCCC4)cc3)n2)cc1OC |
| InChI | InChI=1S/C25H29N3O2S2/c1-29-22-13-12-19(14-23(22)30-2)21-16-32-24(28-21)18-10-8-17(9-11-18)15-26-25(31)27-20-6-4-3-5-7-20/h8-14,16,20H,3-7,15H2,1-2H3,(H2,26,27,31) |
| InChIKey | VSBHUWDKUGHGKE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|