C23H25N3O4S2 — CID 108781161
2-methoxy-4,5-dimethyl-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 108781161) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethyl-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 2-methoxy-4,5-dimethyl-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108781161 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-methoxy-4,5-dimethyl-N-[4-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)Nc1nc(-c2ccc3c(c2)C(C)(C)C(=O)N3C)cs1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-13-9-19(30-6)20(10-14(13)2)32(28,29)25-22-24-17(12-31-22)15-7-8-18-16(11-15)23(3,4)21(27)26(18)5/h7-12H,1-6H3,(H,24,25) |
| InChIKey | IMNDVHXVQJZZAS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|