C12H12ClN3O4S2 — CID 108782233
4-chloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 108782233) has the molecular formula C12H12ClN3O4S2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 4-chloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108782233 |
| Molecular Formula | C12H12ClN3O4S2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 4-chloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1nc(C(C)NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C12H12ClN3O4S2/c1-7(11-6-21-8(2)14-11)15-22(19,20)9-3-4-10(13)12(5-9)16(17)18/h3-7,15H,1-2H3 |
| InChIKey | MCQYBLFLCAZANF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|