C20H22N2O3S2 — CID 108782420
N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,4-dimethylbenzenesulfonamide (PubChem CID 108782420) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 108782420 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]-2,4-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(-c2nc(NS(=O)(=O)c3ccc(C)cc3C)sc2C)cc1C |
| InChI | InChI=1S/C20H22N2O3S2/c1-12-6-9-18(14(3)10-12)27(23,24)22-20-21-19(15(4)26-20)16-7-8-17(25-5)13(2)11-16/h6-11H,1-5H3,(H,21,22) |
| InChIKey | NPFLTPQHHNTMEE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|