C18H21ClN4O3 — CID 108786227
2-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 108786227) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 108786227 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(3-morpholin-4-ylpropyl)-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cnc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C18H21ClN4O3/c19-14-4-2-13(3-5-14)16-21-12-15(18(25)22-16)17(24)20-6-1-7-23-8-10-26-11-9-23/h2-5,12H,1,6-11H2,(H,20,24)(H,21,22,25) |
| InChIKey | VWQATEPXABHEJO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|