C12H11ClN4OS — CID 108787577
N-(2-chloro-3-pyridinyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (PubChem CID 108787577) has the molecular formula C12H11ClN4OS and a molecular weight of 294.77 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 108787577 |
| Molecular Formula | C12H11ClN4OS |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| SMILES | O=C(CC1=CSC2=NCCN12)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H11ClN4OS/c13-11-9(2-1-3-14-11)16-10(18)6-8-7-19-12-15-4-5-17(8)12/h1-3,7H,4-6H2,(H,16,18) |
| InChIKey | RQBYQMIYVSRCQX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|