About 2,5-Dibromofuran
2,5-Dibromofuran (PubChem CID 10878846) has the molecular formula C4H2Br2O
and a molecular weight of 225.87 g/mol. Its IUPAC name is 2,5-dibromofuran.
Molecular Properties
| Compound Name | 2,5-Dibromofuran |
| PubChem CID | 10878846 |
| Molecular Formula | C4H2Br2O |
| Molecular Weight | 225.87 g/mol |
| Exact Mass | 225.85 |
| IUPAC Name | 2,5-dibromofuran |
| SMILES | C1=C(OC(=C1)Br)Br |
| InChI | InChI=1S/C4H2Br2O/c5-3-1-2-4(6)7-3/h1-2H |
| InChIKey | LACYYWKMIJOHLU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | 58 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-Dibromofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-Dibromofuran?
The IUPAC name of 2,5-Dibromofuran (CID 10878846) is 2,5-dibromofuran.
What is the SMILES notation for 2,5-Dibromofuran?
The canonical SMILES for 2,5-Dibromofuran is C1=C(OC(=C1)Br)Br.
What is the InChIKey of 2,5-Dibromofuran?
The InChIKey is LACYYWKMIJOHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Br2O/c5-3-1-2-4(6)7-3/h1-2H.
What are the key properties of 2,5-Dibromofuran?
2,5-Dibromofuran has a molecular weight of 225.87 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-Dibromofuran is sourced from PubChem (CID 10878846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).