C10H16O4S — CID 10879010
(5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]thiolan-2-one (PubChem CID 10879010) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is (5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]thiolan-2-one.
| Compound Name | (5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]thiolan-2-one |
|---|---|
| PubChem CID | 10879010 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]thiolan-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H](O)[C@H]2CCC(=O)S2)O1 |
| InChI | InChI=1S/C10H16O4S/c1-10(2)13-5-6(14-10)9(12)7-3-4-8(11)15-7/h6-7,9,12H,3-5H2,1-2H3/t6-,7-,9-/m1/s1 |
| InChIKey | PHCSADUDCXVPON-ZXFLCMHBSA-N |
| XLogP | 0.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|