C15H17NO5S — CID 108793248
2-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-sulfanylpropanoic acid (PubChem CID 108793248) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 108793248 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)NC(CS)C(=O)O)ccc2O1 |
| InChI | InChI=1S/C15H17NO5S/c1-15(2)6-11(17)9-5-8(3-4-12(9)21-15)13(18)16-10(7-22)14(19)20/h3-5,10,22H,6-7H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | AHGKHTUNUVSTNB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|