C18H15ClN4O4S2 — CID 108796370
N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 108796370) has the molecular formula C18H15ClN4O4S2 and a molecular weight of 450.93 g/mol. Its IUPAC name is N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 108796370 |
| Molecular Formula | C18H15ClN4O4S2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C18H15ClN4O4S2/c19-16-8-9-17(22-21-16)23-29(26,27)13-5-3-12(4-6-13)20-18(25)10-7-14(24)15-2-1-11-28-15/h1-6,8-9,11H,7,10H2,(H,20,25)(H,22,23) |
| InChIKey | GTQGTZSCUIQNSW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |