C13H20N2S2 — CID 10880109
N'-[bis(methylsulfanyl)-phenylmethyl]-N,N-dimethylethanimidamide (PubChem CID 10880109) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is N'-[bis(methylsulfanyl)-phenylmethyl]-N,N-dimethylethanimidamide.
| Compound Name | N'-[bis(methylsulfanyl)-phenylmethyl]-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 10880109 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N'-[bis(methylsulfanyl)-phenylmethyl]-N,N-dimethylethanimidamide |
| SMILES | CSC(/N=C(\C)N(C)C)(SC)c1ccccc1 |
| InChI | InChI=1S/C13H20N2S2/c1-11(15(2)3)14-13(16-4,17-5)12-9-7-6-8-10-12/h6-10H,1-5H3/b14-11+ |
| InChIKey | YGRRXTMMGBLDMI-SDNWHVSQSA-N |
| XLogP | 3.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|