C12H12N2S2 — CID 14000860
2-(dimethylamino)-4-phenyl-1,3-thiazine-6-thione (PubChem CID 14000860) has the molecular formula C12H12N2S2 and a molecular weight of 248.38 g/mol. Its IUPAC name is 2-(dimethylamino)-4-phenyl-1,3-thiazine-6-thione.
| Compound Name | 2-(dimethylamino)-4-phenyl-1,3-thiazine-6-thione |
|---|---|
| PubChem CID | 14000860 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-(dimethylamino)-4-phenyl-1,3-thiazine-6-thione |
| SMILES | CN(C)c1nc(-c2ccccc2)cc(=S)s1 |
| InChI | InChI=1S/C12H12N2S2/c1-14(2)12-13-10(8-11(15)16-12)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | ZMZLEBDKMQAPFP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|