C13H20O6 — CID 10880240
[(3aS,4R,6R,7S,7aS)-6-hydroxy-4-(methoxymethyl)-6-methyl-3-oxo-4,5,7,7a-tetrahydro-3aH-1-benzofuran-7-yl] acetate (PubChem CID 10880240) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is [(3aS,4R,6R,7S,7aS)-6-hydroxy-4-(methoxymethyl)-6-methyl-3-oxo-4,5,7,7a-tetrahydro-3aH-1-benzofuran-7-yl] acetate.
| Compound Name | [(3aS,4R,6R,7S,7aS)-6-hydroxy-4-(methoxymethyl)-6-methyl-3-oxo-4,5,7,7a-tetrahydro-3aH-1-benzofuran-7-yl] acetate |
|---|---|
| PubChem CID | 10880240 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [(3aS,4R,6R,7S,7aS)-6-hydroxy-4-(methoxymethyl)-6-methyl-3-oxo-4,5,7,7a-tetrahydro-3aH-1-benzofuran-7-yl] acetate |
| SMILES | COC[C@@H]1C[C@@](C)(O)[C@@H](OC(C)=O)[C@H]2OCC(=O)[C@@H]12 |
| InChI | InChI=1S/C13H20O6/c1-7(14)19-12-11-10(9(15)6-18-11)8(5-17-3)4-13(12,2)16/h8,10-12,16H,4-6H2,1-3H3/t8-,10+,11-,12-,13+/m0/s1 |
| InChIKey | ADCGSRGGMUPUCK-XZDSOIIUSA-N |
| XLogP | -0.08 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |