C21H16ClN3O4S — CID 108802406
3-(2-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 108802406) has the molecular formula C21H16ClN3O4S and a molecular weight of 441.90 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(2-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 108802406 |
| Molecular Formula | C21H16ClN3O4S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(CCOc1ccccc1Cl)Nc1ncc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C21H16ClN3O4S/c22-16-7-3-4-8-17(16)29-10-9-18(26)24-21-23-11-13(30-21)12-25-19(27)14-5-1-2-6-15(14)20(25)28/h1-8,11H,9-10,12H2,(H,23,24,26) |
| InChIKey | HAVTTXHBGQBNDO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|