C21H18N4O4S — CID 108806618
2-(2,6-dimethyl-4-oxo-1-pyridinyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 108806618) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-oxo-1-pyridinyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2,6-dimethyl-4-oxo-1-pyridinyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 108806618 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-(2,6-dimethyl-4-oxo-1-pyridinyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cc(=O)cc(C)n1CC(=O)Nc1ncc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C21H18N4O4S/c1-12-7-14(26)8-13(2)24(12)11-18(27)23-21-22-9-15(30-21)10-25-19(28)16-5-3-4-6-17(16)20(25)29/h3-9H,10-11H2,1-2H3,(H,22,23,27) |
| InChIKey | BHZJYNZZAUZKMU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|