C17H18ClNO2 — CID 10881235
(3S,4S)-1-benzyl-3-(2-chloroprop-2-enyl)-4-prop-2-enylpyrrolidine-2,5-dione (PubChem CID 10881235) has the molecular formula C17H18ClNO2 and a molecular weight of 303.79 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-(2-chloroprop-2-enyl)-4-prop-2-enylpyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-1-benzyl-3-(2-chloroprop-2-enyl)-4-prop-2-enylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10881235 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (3S,4S)-1-benzyl-3-(2-chloroprop-2-enyl)-4-prop-2-enylpyrrolidine-2,5-dione |
| SMILES | C=CC[C@@H]1C(=O)N(Cc2ccccc2)C(=O)[C@H]1CC(=C)Cl |
| InChI | InChI=1S/C17H18ClNO2/c1-3-7-14-15(10-12(2)18)17(21)19(16(14)20)11-13-8-5-4-6-9-13/h3-6,8-9,14-15H,1-2,7,10-11H2/t14-,15-/m0/s1 |
| InChIKey | NRERAOWMZJZMIU-GJZGRUSLSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|