C19H18N4O3 — CID 108817729
3-[[(Z)-3-(N-(4-aminophenyl)anilino)-2-cyanoprop-2-enoyl]amino]propanoic acid (PubChem CID 108817729) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-[[(Z)-3-(N-(4-aminophenyl)anilino)-2-cyanoprop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-3-(N-(4-aminophenyl)anilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817729 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-[[(Z)-3-(N-(4-aminophenyl)anilino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
| SMILES | N#C/C(=C/N(c1ccccc1)c1ccc(N)cc1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C19H18N4O3/c20-12-14(19(26)22-11-10-18(24)25)13-23(16-4-2-1-3-5-16)17-8-6-15(21)7-9-17/h1-9,13H,10-11,21H2,(H,22,26)(H,24,25)/b14-13- |
| InChIKey | JENFRZDZOAFNNB-YPKPFQOOSA-N |
| XLogP | 2.41 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|