C17H21N3O4S — CID 108819591
3-[[(Z)-2-cyano-3-[(2-methylcyclohexyl)amino]prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819591) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-[(2-methylcyclohexyl)amino]prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-[(2-methylcyclohexyl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819591 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-[(2-methylcyclohexyl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | CC1CCCCC1N/C=C(/C#N)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H21N3O4S/c1-12-5-2-3-8-16(12)19-11-13(10-18)17(21)20-14-6-4-7-15(9-14)25(22,23)24/h4,6-7,9,11-12,16,19H,2-3,5,8H2,1H3,(H,20,21)(H,22,23,24)/b13-11- |
| InChIKey | MLHQTUFMJLNBRL-QBFSEMIESA-N |
| XLogP | 2.45 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|