C20H40O4 — CID 10882494
ethyl (2S,3R)-2,3-dihydroxyoctadecanoate (PubChem CID 10882494) has the molecular formula C20H40O4 and a molecular weight of 344.54 g/mol. Its IUPAC name is ethyl (2S,3R)-2,3-dihydroxyoctadecanoate.
| Compound Name | ethyl (2S,3R)-2,3-dihydroxyoctadecanoate |
|---|---|
| PubChem CID | 10882494 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | ethyl (2S,3R)-2,3-dihydroxyoctadecanoate |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)[C@H](O)C(=O)OCC |
| InChI | InChI=1S/C20H40O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(21)19(22)20(23)24-4-2/h18-19,21-22H,3-17H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | PLQPHWGIPHPMOY-MOPGFXCFSA-N |
| XLogP | 4.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|