C20H26O5 — CID 10882528
methyl (4aR,5S,8aS)-5-[2-[(1S)-1-methyl-4-oxocyclopent-2-en-1-yl]ethyl]-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate (PubChem CID 10882528) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is methyl (4aR,5S,8aS)-5-[2-[(1S)-1-methyl-4-oxocyclopent-2-en-1-yl]ethyl]-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aR,5S,8aS)-5-[2-[(1S)-1-methyl-4-oxocyclopent-2-en-1-yl]ethyl]-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 10882528 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | methyl (4aR,5S,8aS)-5-[2-[(1S)-1-methyl-4-oxocyclopent-2-en-1-yl]ethyl]-4,7-dioxo-2,3,5,6,8,8a-hexahydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)CCC[C@H]1CC(=O)C[C@@H]2CC[C@]1(C)C=CC(=O)C1 |
| InChI | InChI=1S/C20H26O5/c1-19(9-7-15(21)12-19)8-6-14-11-16(22)10-13-4-3-5-17(23)20(13,14)18(24)25-2/h7,9,13-14H,3-6,8,10-12H2,1-2H3/t13-,14-,19+,20+/m0/s1 |
| InChIKey | ARGMPJRPMGGVQY-AFHBHXEDSA-N |
| XLogP | 2.81 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|