C18H22ClN3O2 — CID 108827780
(Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-ethylpiperidin-1-yl)prop-2-enamide (PubChem CID 108827780) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-ethylpiperidin-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-ethylpiperidin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108827780 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (Z)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-(2-ethylpiperidin-1-yl)prop-2-enamide |
| SMILES | CCC1CCCCN1/C=C(/C#N)C(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C18H22ClN3O2/c1-3-15-6-4-5-9-22(15)12-13(11-20)18(23)21-16-10-14(19)7-8-17(16)24-2/h7-8,10,12,15H,3-6,9H2,1-2H3,(H,21,23)/b13-12- |
| InChIKey | BUGMGOMBSHXDFQ-SEYXRHQNSA-N |
| XLogP | 3.96 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|