C19H23NO2S2 — CID 10882956
1-(4-methylphenyl)sulfonyl-2-(2-methyl-1-thiophen-2-ylprop-1-enyl)pyrrolidine (PubChem CID 10882956) has the molecular formula C19H23NO2S2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-(2-methyl-1-thiophen-2-ylprop-1-enyl)pyrrolidine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-(2-methyl-1-thiophen-2-ylprop-1-enyl)pyrrolidine |
|---|---|
| PubChem CID | 10882956 |
| Molecular Formula | C19H23NO2S2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-(2-methyl-1-thiophen-2-ylprop-1-enyl)pyrrolidine |
| SMILES | CC(C)=C(c1cccs1)C1CCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23NO2S2/c1-14(2)19(18-7-5-13-23-18)17-6-4-12-20(17)24(21,22)16-10-8-15(3)9-11-16/h5,7-11,13,17H,4,6,12H2,1-3H3 |
| InChIKey | LIBGYPSZIDOLAZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |