C21H41NO3Si — CID 10883494
(6S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1S,2R)-1-hydroxy-2-methylhexyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 10883494) has the molecular formula C21H41NO3Si and a molecular weight of 383.65 g/mol. Its IUPAC name is (6S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1S,2R)-1-hydroxy-2-methylhexyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (6S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1S,2R)-1-hydroxy-2-methylhexyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10883494 |
| Molecular Formula | C21H41NO3Si |
| Molecular Weight | 383.65 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | (6S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1S,2R)-1-hydroxy-2-methylhexyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CCCC[C@@H](C)[C@H](O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C21H41NO3Si/c1-8-9-11-15(2)19(23)16-14-18(25-26(6,7)21(3,4)5)17-12-10-13-22(17)20(16)24/h15-19,23H,8-14H2,1-7H3/t15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | GECYRDUALBIOKP-SPOLIRPYSA-N |
| XLogP | 4.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|