C18H35NO3Si — CID 10980776
(6R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1R)-1-hydroxy-2-methylpropyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 10980776) has the molecular formula C18H35NO3Si and a molecular weight of 341.57 g/mol. Its IUPAC name is (6R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1R)-1-hydroxy-2-methylpropyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (6R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1R)-1-hydroxy-2-methylpropyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10980776 |
| Molecular Formula | C18H35NO3Si |
| Molecular Weight | 341.57 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (6R,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-[(1R)-1-hydroxy-2-methylpropyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)[C@@H](O)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C18H35NO3Si/c1-12(2)16(20)13-11-15(22-23(6,7)18(3,4)5)14-9-8-10-19(14)17(13)21/h12-16,20H,8-11H2,1-7H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | OSRRRPIXGROKTH-QKPAOTATSA-N |
| XLogP | 3.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|