C16H29NO3 — CID 11044271
(6R,8S,8aS)-8-hydroxy-6-[(1R,2R)-1-hydroxy-2-methylhexyl]-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one (PubChem CID 11044271) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (6R,8S,8aS)-8-hydroxy-6-[(1R,2R)-1-hydroxy-2-methylhexyl]-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one.
| Compound Name | (6R,8S,8aS)-8-hydroxy-6-[(1R,2R)-1-hydroxy-2-methylhexyl]-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 11044271 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (6R,8S,8aS)-8-hydroxy-6-[(1R,2R)-1-hydroxy-2-methylhexyl]-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one |
| SMILES | CCCC[C@@H](C)[C@@H](O)[C@H]1C[C@](C)(O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C16H29NO3/c1-4-5-7-11(2)14(18)12-10-16(3,20)13-8-6-9-17(13)15(12)19/h11-14,18,20H,4-10H2,1-3H3/t11-,12-,13+,14-,16+/m1/s1 |
| InChIKey | BZOALJQVKZROGI-SSZWKKLZSA-N |
| XLogP | 1.94 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |