C15H16FN3O2 — CID 108839223
(Z)-2-cyano-3-(4-fluoroanilino)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 108839223) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-fluoroanilino)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-fluoroanilino)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108839223 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (Z)-2-cyano-3-(4-fluoroanilino)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(F)cc1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C15H16FN3O2/c16-12-3-5-13(6-4-12)18-9-11(8-17)15(20)19-10-14-2-1-7-21-14/h3-6,9,14,18H,1-2,7,10H2,(H,19,20)/b11-9- |
| InChIKey | LHGQOEFMSIDCNJ-LUAWRHEFSA-N |
| XLogP | 1.94 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|