C19H26N4O2 — CID 108839374
(Z)-2-cyano-3-[4-(diethylamino)anilino]-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 108839374) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(diethylamino)anilino]-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(diethylamino)anilino]-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108839374 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (Z)-2-cyano-3-[4-(diethylamino)anilino]-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | CCN(CC)c1ccc(N/C=C(/C#N)C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C19H26N4O2/c1-3-23(4-2)17-9-7-16(8-10-17)21-13-15(12-20)19(24)22-14-18-6-5-11-25-18/h7-10,13,18,21H,3-6,11,14H2,1-2H3,(H,22,24)/b15-13- |
| InChIKey | BPCHBLOSBDBTFB-SQFISAMPSA-N |
| XLogP | 2.65 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|