C13H15N5O2 — CID 108839275
(Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-(pyrimidin-2-ylamino)prop-2-enamide (PubChem CID 108839275) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is (Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-(pyrimidin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108839275 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (Z)-2-cyano-N-(oxolan-2-ylmethyl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncccn1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C13H15N5O2/c14-7-10(8-18-13-15-4-2-5-16-13)12(19)17-9-11-3-1-6-20-11/h2,4-5,8,11H,1,3,6,9H2,(H,17,19)(H,15,16,18)/b10-8- |
| InChIKey | GHPUZHNVLSTFOB-NTMALXAHSA-N |
| XLogP | 0.59 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|