C17H19N3O4 — CID 108839451
methyl 3-[[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]amino]benzoate (PubChem CID 108839451) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is methyl 3-[[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]amino]benzoate.
| Compound Name | methyl 3-[[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108839451 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl 3-[[(Z)-2-cyano-3-oxo-3-(oxolan-2-ylmethylamino)prop-1-enyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(N/C=C(/C#N)C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-23-17(22)12-4-2-5-14(8-12)19-10-13(9-18)16(21)20-11-15-6-3-7-24-15/h2,4-5,8,10,15,19H,3,6-7,11H2,1H3,(H,20,21)/b13-10- |
| InChIKey | DSKLDDFQGQPTEE-RAXLEYEMSA-N |
| XLogP | 1.59 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|