C23H28O6S — CID 10884536
(5E)-3-(benzenesulfonyl)-5-[2-(oxan-2-yloxy)hept-5-ynylidene]oxan-2-one (PubChem CID 10884536) has the molecular formula C23H28O6S and a molecular weight of 432.54 g/mol. Its IUPAC name is (5E)-3-(benzenesulfonyl)-5-[2-(oxan-2-yloxy)hept-5-ynylidene]oxan-2-one.
| Compound Name | (5E)-3-(benzenesulfonyl)-5-[2-(oxan-2-yloxy)hept-5-ynylidene]oxan-2-one |
|---|---|
| PubChem CID | 10884536 |
| Molecular Formula | C23H28O6S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (5E)-3-(benzenesulfonyl)-5-[2-(oxan-2-yloxy)hept-5-ynylidene]oxan-2-one |
| SMILES | CC#CCCC(/C=C1/COC(=O)C(S(=O)(=O)c2ccccc2)C1)OC1CCCCO1 |
| InChI | InChI=1S/C23H28O6S/c1-2-3-5-10-19(29-22-13-8-9-14-27-22)15-18-16-21(23(24)28-17-18)30(25,26)20-11-6-4-7-12-20/h4,6-7,11-12,15,19,21-22H,5,8-10,13-14,16-17H2,1H3/b18-15+ |
| InChIKey | KBZSHXPBIKMQTR-OBGWFSINSA-N |
| XLogP | 3.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|