C26H42O7SSi — CID 11752847
methyl (E,5R)-2-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(oxan-2-yloxy)oct-6-enoate (PubChem CID 11752847) has the molecular formula C26H42O7SSi and a molecular weight of 526.77 g/mol. Its IUPAC name is methyl (E,5R)-2-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(oxan-2-yloxy)oct-6-enoate.
| Compound Name | methyl (E,5R)-2-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(oxan-2-yloxy)oct-6-enoate |
|---|---|
| PubChem CID | 11752847 |
| Molecular Formula | C26H42O7SSi |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | methyl (E,5R)-2-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-8-(oxan-2-yloxy)oct-6-enoate |
| SMILES | COC(=O)C(CC[C@H](/C=C/COC1CCCCO1)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H42O7SSi/c1-26(2,3)35(5,6)33-21(13-12-20-32-24-16-10-11-19-31-24)17-18-23(25(27)30-4)34(28,29)22-14-8-7-9-15-22/h7-9,12-15,21,23-24H,10-11,16-20H2,1-6H3/b13-12+/t21-,23?,24?/m0/s1 |
| InChIKey | JBXPIAPOVQELTG-QBWQAWKESA-N |
| XLogP | 5.27 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|