C21H34O5SSi — CID 15466793
[(E)-1-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate (PubChem CID 15466793) has the molecular formula C21H34O5SSi and a molecular weight of 426.65 g/mol. Its IUPAC name is [(E)-1-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate.
| Compound Name | [(E)-1-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 15466793 |
| Molecular Formula | C21H34O5SSi |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(E)-1-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate |
| SMILES | CC(=O)OC(/C=C/S(=O)(=O)c1ccccc1)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O5SSi/c1-18(22)26-19(12-10-11-16-25-28(5,6)21(2,3)4)15-17-27(23,24)20-13-8-7-9-14-20/h7-9,13-15,17,19H,10-12,16H2,1-6H3/b17-15+ |
| InChIKey | PYSPRBCKXSDALZ-BMRADRMJSA-N |
| XLogP | 5.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|