C16H26N4O4S — CID 108846665
2-[[(Z)-2-cyano-3-(3-morpholin-4-ylpropylamino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 108846665) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-(3-morpholin-4-ylpropylamino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-(3-morpholin-4-ylpropylamino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108846665 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-(3-morpholin-4-ylpropylamino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)/C(C#N)=C\NCCCN1CCOCC1)C(=O)O |
| InChI | InChI=1S/C16H26N4O4S/c1-25-10-3-14(16(22)23)19-15(21)13(11-17)12-18-4-2-5-20-6-8-24-9-7-20/h12,14,18H,2-10H2,1H3,(H,19,21)(H,22,23)/b13-12- |
| InChIKey | VPSHIRDBSLGDKX-SEYXRHQNSA-N |
| XLogP | 0.03 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|