C14H22N4O5S — CID 108846897
2-[[(Z)-2-cyano-3-[2-(ethoxycarbonylamino)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 108846897) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[2-(ethoxycarbonylamino)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-[2-(ethoxycarbonylamino)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108846897 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[2-(ethoxycarbonylamino)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCOC(=O)NCCN/C=C(/C#N)C(=O)NC(CCSC)C(=O)O |
| InChI | InChI=1S/C14H22N4O5S/c1-3-23-14(22)17-6-5-16-9-10(8-15)12(19)18-11(13(20)21)4-7-24-2/h9,11,16H,3-7H2,1-2H3,(H,17,22)(H,18,19)(H,20,21)/b10-9- |
| InChIKey | IKFNPDKVSZPDGB-KTKRTIGZSA-N |
| XLogP | 0.05 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|